C12H11FN4O2S — CID 115479600
[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-fluoropyrimidin-2-yl]hydrazine (PubChem CID 115479600) has the molecular formula C12H11FN4O2S and a molecular weight of 294.31 g/mol. Its IUPAC name is [4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-fluoropyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-fluoropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 115479600 |
| Molecular Formula | C12H11FN4O2S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | [4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-fluoropyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(F)c(Sc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C12H11FN4O2S/c13-8-6-15-12(17-14)16-11(8)20-7-1-2-9-10(5-7)19-4-3-18-9/h1-2,5-6H,3-4,14H2,(H,15,16,17) |
| InChIKey | URRMSWYQDKOBBD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|