C15H15N3O2S — CID 115479801
6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)pyridine-3-carboximidamide (PubChem CID 115479801) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)pyridine-3-carboximidamide.
| Compound Name | 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 115479801 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2ccc3c(c2)OCCCO3)nc1 |
| InChI | InChI=1S/C15H15N3O2S/c16-15(17)10-2-5-14(18-9-10)21-11-3-4-12-13(8-11)20-7-1-6-19-12/h2-5,8-9H,1,6-7H2,(H3,16,17) |
| InChIKey | AVQDNBRIDPFDQN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|