C11H8F4N4S — CID 114567844
[4-(4-fluorophenyl)sulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine (PubChem CID 114567844) has the molecular formula C11H8F4N4S and a molecular weight of 304.27 g/mol. Its IUPAC name is [4-(4-fluorophenyl)sulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(4-fluorophenyl)sulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114567844 |
| Molecular Formula | C11H8F4N4S |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | [4-(4-fluorophenyl)sulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(Sc2ccc(F)cc2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H8F4N4S/c12-6-1-3-7(4-2-6)20-9-5-8(11(13,14)15)17-10(18-9)19-16/h1-5H,16H2,(H,17,18,19) |
| InChIKey | PKQRMLUCXJHFGV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|