C13H13F3N4S — CID 114567852
[4-(2,5-dimethylphenyl)sulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine (PubChem CID 114567852) has the molecular formula C13H13F3N4S and a molecular weight of 314.34 g/mol. Its IUPAC name is [4-(2,5-dimethylphenyl)sulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,5-dimethylphenyl)sulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114567852 |
| Molecular Formula | C13H13F3N4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | [4-(2,5-dimethylphenyl)sulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| SMILES | Cc1ccc(C)c(Sc2cc(C(F)(F)F)nc(NN)n2)c1 |
| InChI | InChI=1S/C13H13F3N4S/c1-7-3-4-8(2)9(5-7)21-11-6-10(13(14,15)16)18-12(19-11)20-17/h3-6H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | JKWSHTZVEVEHNM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|