C12H11F4N5 — CID 114567318
N-(2-fluoro-4-methylphenyl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114567318) has the molecular formula C12H11F4N5 and a molecular weight of 301.25 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(2-fluoro-4-methylphenyl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114567318 |
| Molecular Formula | C12H11F4N5 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2cc(C(F)(F)F)nc(NN)n2)c(F)c1 |
| InChI | InChI=1S/C12H11F4N5/c1-6-2-3-8(7(13)4-6)18-10-5-9(12(14,15)16)19-11(20-10)21-17/h2-5H,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | XNQIXGSZFMZWEB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|