C11H8Cl2F3N5 — CID 114567317
N-(2,3-dichlorophenyl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114567317) has the molecular formula C11H8Cl2F3N5 and a molecular weight of 338.12 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(2,3-dichlorophenyl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114567317 |
| Molecular Formula | C11H8Cl2F3N5 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | NNc1nc(Nc2cccc(Cl)c2Cl)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H8Cl2F3N5/c12-5-2-1-3-6(9(5)13)18-8-4-7(11(14,15)16)19-10(20-8)21-17/h1-4H,17H2,(H2,18,19,20,21) |
| InChIKey | WIUMTDMCDSNCBN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|