C7H7F5N4O — CID 114567822
[4-(2,2-difluoroethoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine (PubChem CID 114567822) has the molecular formula C7H7F5N4O and a molecular weight of 258.15 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,2-difluoroethoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114567822 |
| Molecular Formula | C7H7F5N4O |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | [4-(2,2-difluoroethoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(OCC(F)F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H7F5N4O/c8-4(9)2-17-5-1-3(7(10,11)12)14-6(15-5)16-13/h1,4H,2,13H2,(H,14,15,16) |
| InChIKey | ZAFYXWZIPQCHOZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|