C8H6F8N4O — CID 114567815
[4-(2,2,3,3,3-pentafluoropropoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine (PubChem CID 114567815) has the molecular formula C8H6F8N4O and a molecular weight of 326.15 g/mol. Its IUPAC name is [4-(2,2,3,3,3-pentafluoropropoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,2,3,3,3-pentafluoropropoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114567815 |
| Molecular Formula | C8H6F8N4O |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | [4-(2,2,3,3,3-pentafluoropropoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(OCC(F)(F)C(F)(F)F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H6F8N4O/c9-6(10,8(14,15)16)2-21-4-1-3(7(11,12)13)18-5(19-4)20-17/h1H,2,17H2,(H,18,19,20) |
| InChIKey | NOAPXMNUNYDYAE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|