C7H7F5N4O — CID 80922935
[6-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]hydrazine (PubChem CID 80922935) has the molecular formula C7H7F5N4O and a molecular weight of 258.15 g/mol. Its IUPAC name is [6-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]hydrazine.
| Compound Name | [6-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80922935 |
| Molecular Formula | C7H7F5N4O |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | [6-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]hydrazine |
| SMILES | NNc1cncc(OCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C7H7F5N4O/c8-6(9,7(10,11)12)3-17-5-2-14-1-4(15-5)16-13/h1-2H,3,13H2,(H,15,16) |
| InChIKey | SWKCLSICGSCHBQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|