C11H14F5N3O — CID 80963004
N-methyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-propan-2-ylpyrimidin-4-amine (PubChem CID 80963004) has the molecular formula C11H14F5N3O and a molecular weight of 299.24 g/mol. Its IUPAC name is N-methyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-methyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80963004 |
| Molecular Formula | C11H14F5N3O |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-methyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CNc1cc(OCC(F)(F)C(F)(F)F)nc(C(C)C)n1 |
| InChI | InChI=1S/C11H14F5N3O/c1-6(2)9-18-7(17-3)4-8(19-9)20-5-10(12,13)11(14,15)16/h4,6H,5H2,1-3H3,(H,17,18,19) |
| InChIKey | RYEGWILNXHPBTC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|