C14H24N4O — CID 80962688
N-methyl-2-propan-2-yl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine (PubChem CID 80962688) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is N-methyl-2-propan-2-yl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine.
| Compound Name | N-methyl-2-propan-2-yl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80962688 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-methyl-2-propan-2-yl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine |
| SMILES | CNc1cc(OCCN2CCCC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C14H24N4O/c1-11(2)14-16-12(15-3)10-13(17-14)19-9-8-18-6-4-5-7-18/h10-11H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | RZYONZFHZZAOHE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |