C8H12F3N5 — CID 80924055
6-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)pyrazin-2-amine (PubChem CID 80924055) has the molecular formula C8H12F3N5 and a molecular weight of 235.21 g/mol. Its IUPAC name is 6-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)pyrazin-2-amine.
| Compound Name | 6-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 80924055 |
| Molecular Formula | C8H12F3N5 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 6-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)pyrazin-2-amine |
| SMILES | CN(CCC(F)(F)F)c1cncc(NN)n1 |
| InChI | InChI=1S/C8H12F3N5/c1-16(3-2-8(9,10)11)7-5-13-4-6(14-7)15-12/h4-5H,2-3,12H2,1H3,(H,14,15) |
| InChIKey | HYPYDYAUIIYCSQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|