C12H20F3N5 — CID 80968252
2-tert-butyl-6-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine (PubChem CID 80968252) has the molecular formula C12H20F3N5 and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-tert-butyl-6-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80968252 |
| Molecular Formula | C12H20F3N5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-tert-butyl-6-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
| SMILES | CN(CCC(F)(F)F)c1cc(NN)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H20F3N5/c1-11(2,3)10-17-8(19-16)7-9(18-10)20(4)6-5-12(13,14)15/h7H,5-6,16H2,1-4H3,(H,17,18,19) |
| InChIKey | JBVCENYQGFZOKY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|