C8H5F8N3O — CID 114566550
4-(2,2,3,3,3-pentafluoropropoxy)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566550) has the molecular formula C8H5F8N3O and a molecular weight of 311.13 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropoxy)-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropoxy)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566550 |
| Molecular Formula | C8H5F8N3O |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropoxy)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Nc1nc(OCC(F)(F)C(F)(F)F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H5F8N3O/c9-6(10,8(14,15)16)2-20-4-1-3(7(11,12)13)18-5(17)19-4/h1H,2H2,(H2,17,18,19) |
| InChIKey | XEMMYOUEJKOZCM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|