C12H11F3N4O2 — CID 114567735
[4-(3-methoxyphenoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine (PubChem CID 114567735) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is [4-(3-methoxyphenoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(3-methoxyphenoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114567735 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [4-(3-methoxyphenoxy)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| SMILES | COc1cccc(Oc2cc(C(F)(F)F)nc(NN)n2)c1 |
| InChI | InChI=1S/C12H11F3N4O2/c1-20-7-3-2-4-8(5-7)21-10-6-9(12(13,14)15)17-11(18-10)19-16/h2-6H,16H2,1H3,(H,17,18,19) |
| InChIKey | VJIGRHJXXMIQDP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|