C9H8F3N7OS — CID 136955868
4-amino-2-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 136955868) has the molecular formula C9H8F3N7OS and a molecular weight of 319.27 g/mol. Its IUPAC name is 4-amino-2-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136955868 |
| Molecular Formula | C9H8F3N7OS |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 4-amino-2-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | NNc1nc(Sc2nc(N)cc(=O)[nH]2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H8F3N7OS/c10-9(11,12)3-1-6(18-7(15-3)19-14)21-8-16-4(13)2-5(20)17-8/h1-2H,14H2,(H,15,18,19)(H3,13,16,17,20) |
| InChIKey | IKJDVQXUOWTKBM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|