C12H22N6OS — CID 106497966
N,N-diethyl-4-hydrazinyl-6-(oxolan-2-ylmethylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 106497966) has the molecular formula C12H22N6OS and a molecular weight of 298.42 g/mol. Its IUPAC name is N,N-diethyl-4-hydrazinyl-6-(oxolan-2-ylmethylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | N,N-diethyl-4-hydrazinyl-6-(oxolan-2-ylmethylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106497966 |
| Molecular Formula | C12H22N6OS |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N,N-diethyl-4-hydrazinyl-6-(oxolan-2-ylmethylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(NN)nc(SCC2CCCO2)n1 |
| InChI | InChI=1S/C12H22N6OS/c1-3-18(4-2)11-14-10(17-13)15-12(16-11)20-8-9-6-5-7-19-9/h9H,3-8,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | NLQXSUQTTKWDJA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|