C9H12F3N3O2 — CID 114566256
2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]oxyethanol (PubChem CID 114566256) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is 2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]oxyethanol.
| Compound Name | 2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 114566256 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]oxyethanol |
| SMILES | CCNc1nc(OCCO)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N3O2/c1-2-13-8-14-6(9(10,11)12)5-7(15-8)17-4-3-16/h5,16H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | NRMNBSFHHAUHEI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |