C11H15F3N2S — CID 107765534
6-(3-methylbutan-2-ylsulfanyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 107765534) has the molecular formula C11H15F3N2S and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-(3-methylbutan-2-ylsulfanyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(3-methylbutan-2-ylsulfanyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107765534 |
| Molecular Formula | C11H15F3N2S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 6-(3-methylbutan-2-ylsulfanyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)C(C)Sc1cc(C(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C11H15F3N2S/c1-6(2)7(3)17-10-5-8(11(12,13)14)4-9(15)16-10/h4-7H,1-3H3,(H2,15,16) |
| InChIKey | XTKOBKMMWFZPNG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |