C13H11F3N2OS — CID 102720140
6-(4-methoxyphenyl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720140) has the molecular formula C13H11F3N2OS and a molecular weight of 300.31 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(4-methoxyphenyl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720140 |
| Molecular Formula | C13H11F3N2OS |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 6-(4-methoxyphenyl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1ccc(Sc2cc(C(F)(F)F)cc(N)n2)cc1 |
| InChI | InChI=1S/C13H11F3N2OS/c1-19-9-2-4-10(5-3-9)20-12-7-8(13(14,15)16)6-11(17)18-12/h2-7H,1H3,(H2,17,18) |
| InChIKey | QOPHGJSAPLXIJG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |