C8H14N4S — CID 80893169
6-(2-methylpropylsulfanyl)pyrimidine-2,4-diamine (PubChem CID 80893169) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 6-(2-methylpropylsulfanyl)pyrimidine-2,4-diamine.
| Compound Name | 6-(2-methylpropylsulfanyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80893169 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 6-(2-methylpropylsulfanyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)CSc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C8H14N4S/c1-5(2)4-13-7-3-6(9)11-8(10)12-7/h3,5H,4H2,1-2H3,(H4,9,10,11,12) |
| InChIKey | XMBKHKTYWIRYDS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |