C12H16N6S2 — CID 80929796
[2-methylsulfanyl-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-4-yl]hydrazine (PubChem CID 80929796) has the molecular formula C12H16N6S2 and a molecular weight of 308.44 g/mol. Its IUPAC name is [2-methylsulfanyl-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-methylsulfanyl-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80929796 |
| Molecular Formula | C12H16N6S2 |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [2-methylsulfanyl-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(Sc2nc(C)c(C)c(C)n2)n1 |
| InChI | InChI=1S/C12H16N6S2/c1-6-7(2)14-12(15-8(6)3)20-10-5-9(18-13)16-11(17-10)19-4/h5H,13H2,1-4H3,(H,16,17,18) |
| InChIKey | SDBHYOIWEBVWDK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|