C9H10N6OS2 — CID 80924203
2-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 80924203) has the molecular formula C9H10N6OS2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 80924203 |
| Molecular Formula | C9H10N6OS2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | CSc1nc(NN)cc(Sc2nccc(=O)[nH]2)n1 |
| InChI | InChI=1S/C9H10N6OS2/c1-17-9-12-5(15-10)4-7(14-9)18-8-11-3-2-6(16)13-8/h2-4H,10H2,1H3,(H,11,13,16)(H,12,14,15) |
| InChIKey | AURPWELFQFBBND-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|