C13H13N5S2 — CID 80927316
[6-(1H-indol-2-ylsulfanyl)-2-methylsulfanylpyrimidin-4-yl]hydrazine (PubChem CID 80927316) has the molecular formula C13H13N5S2 and a molecular weight of 303.42 g/mol. Its IUPAC name is [6-(1H-indol-2-ylsulfanyl)-2-methylsulfanylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(1H-indol-2-ylsulfanyl)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80927316 |
| Molecular Formula | C13H13N5S2 |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [6-(1H-indol-2-ylsulfanyl)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(Sc2cc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C13H13N5S2/c1-19-13-16-10(18-14)7-12(17-13)20-11-6-8-4-2-3-5-9(8)15-11/h2-7,15H,14H2,1H3,(H,16,17,18) |
| InChIKey | JRSNZMSCVMUKLS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|