C9H11N7O2S2 — CID 107785469
3-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107785469) has the molecular formula C9H11N7O2S2 and a molecular weight of 313.37 g/mol. Its IUPAC name is 3-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107785469 |
| Molecular Formula | C9H11N7O2S2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 3-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | CSc1nc(NN)cc(Sc2nc(=O)c(=O)[nH]n2C)n1 |
| InChI | InChI=1S/C9H11N7O2S2/c1-16-9(13-6(17)7(18)15-16)20-5-3-4(14-10)11-8(12-5)19-2/h3H,10H2,1-2H3,(H,15,18)(H,11,12,14) |
| InChIKey | OVBUYKHQVSJTID-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|