C10H13N7O2S — CID 107785259
3-[2-amino-6-(ethylamino)pyrimidin-4-yl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107785259) has the molecular formula C10H13N7O2S and a molecular weight of 295.33 g/mol. Its IUPAC name is 3-[2-amino-6-(ethylamino)pyrimidin-4-yl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[2-amino-6-(ethylamino)pyrimidin-4-yl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107785259 |
| Molecular Formula | C10H13N7O2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-[2-amino-6-(ethylamino)pyrimidin-4-yl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | CCNc1cc(Sc2nc(=O)c(=O)[nH]n2C)nc(N)n1 |
| InChI | InChI=1S/C10H13N7O2S/c1-3-12-5-4-6(14-9(11)13-5)20-10-15-7(18)8(19)16-17(10)2/h4H,3H2,1-2H3,(H,16,19)(H3,11,12,13,14) |
| InChIKey | OGSLXBNVJRZDBJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|