C13H9F3N4S — CID 106775261
6-(1H-indol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106775261) has the molecular formula C13H9F3N4S and a molecular weight of 310.30 g/mol. Its IUPAC name is 6-(1H-indol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(1H-indol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106775261 |
| Molecular Formula | C13H9F3N4S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 6-(1H-indol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Nc1cc(Sc2cc3ccccc3[nH]2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H9F3N4S/c14-13(15,16)12-19-9(17)6-11(20-12)21-10-5-7-3-1-2-4-8(7)18-10/h1-6,18H,(H2,17,19,20) |
| InChIKey | QBCAVRCJPHLMJK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |