C13H25N5S — CID 102909009
6-hydrazinyl-N-(3-methyl-2-propan-2-ylbutyl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 102909009) has the molecular formula C13H25N5S and a molecular weight of 283.45 g/mol. Its IUPAC name is 6-hydrazinyl-N-(3-methyl-2-propan-2-ylbutyl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(3-methyl-2-propan-2-ylbutyl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102909009 |
| Molecular Formula | C13H25N5S |
| Molecular Weight | 283.45 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 6-hydrazinyl-N-(3-methyl-2-propan-2-ylbutyl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(NN)cc(NCC(C(C)C)C(C)C)n1 |
| InChI | InChI=1S/C13H25N5S/c1-8(2)10(9(3)4)7-15-11-6-12(18-14)17-13(16-11)19-5/h6,8-10H,7,14H2,1-5H3,(H2,15,16,17,18) |
| InChIKey | GDAMGXLRIHIVCC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|