C9H17N5O2S2 — CID 80915241
6-hydrazinyl-2-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)pyrimidin-4-amine (PubChem CID 80915241) has the molecular formula C9H17N5O2S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 6-hydrazinyl-2-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80915241 |
| Molecular Formula | C9H17N5O2S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 6-hydrazinyl-2-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)pyrimidin-4-amine |
| SMILES | CSc1nc(NN)cc(NC(C)CS(C)(=O)=O)n1 |
| InChI | InChI=1S/C9H17N5O2S2/c1-6(5-18(3,15)16)11-7-4-8(14-10)13-9(12-7)17-2/h4,6H,5,10H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | HEMZVGRPOKHQNF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|