C11H20N6OS — CID 80896872
2-[(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]-N-propylpropanamide (PubChem CID 80896872) has the molecular formula C11H20N6OS and a molecular weight of 284.39 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]-N-propylpropanamide.
| Compound Name | 2-[(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 80896872 |
| Molecular Formula | C11H20N6OS |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Nc1cc(NN)nc(SC)n1 |
| InChI | InChI=1S/C11H20N6OS/c1-4-5-13-10(18)7(2)14-8-6-9(17-12)16-11(15-8)19-3/h6-7H,4-5,12H2,1-3H3,(H,13,18)(H2,14,15,16,17) |
| InChIKey | TYUPPRZPIOMJCL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|