C10H16N2O2S2 — CID 115921453
5-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)pyridin-2-amine (PubChem CID 115921453) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 115921453 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 5-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)pyridin-2-amine |
| SMILES | CSc1ccc(NC(C)CS(C)(=O)=O)nc1 |
| InChI | InChI=1S/C10H16N2O2S2/c1-8(7-16(3,13)14)12-10-5-4-9(15-2)6-11-10/h4-6,8H,7H2,1-3H3,(H,11,12) |
| InChIKey | RWASBBATMAWEGM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |