C10H13N5OS — CID 106928882
[4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-methylpyrimidin-2-yl]hydrazine (PubChem CID 106928882) has the molecular formula C10H13N5OS and a molecular weight of 251.31 g/mol. Its IUPAC name is [4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-methylpyrimidin-2-yl]hydrazine.
| Compound Name | [4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-methylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 106928882 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | [4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-methylpyrimidin-2-yl]hydrazine |
| SMILES | Cc1cnc(NN)nc1Sc1nc(C)c(C)o1 |
| InChI | InChI=1S/C10H13N5OS/c1-5-4-12-9(15-11)14-8(5)17-10-13-6(2)7(3)16-10/h4H,11H2,1-3H3,(H,12,14,15) |
| InChIKey | FGHKFQZPNGMOBN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|