C9H10N4OS — CID 106928814
[6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-pyridinyl]hydrazine (PubChem CID 106928814) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is [6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-pyridinyl]hydrazine.
| Compound Name | [6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 106928814 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | [6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-pyridinyl]hydrazine |
| SMILES | Cc1coc(Sc2cccc(NN)n2)n1 |
| InChI | InChI=1S/C9H10N4OS/c1-6-5-14-9(11-6)15-8-4-2-3-7(12-8)13-10/h2-5H,10H2,1H3,(H,12,13) |
| InChIKey | SBIKWXRDJLSNBB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|