C11H12N2O2S — CID 106921500
2-methoxy-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]aniline (PubChem CID 106921500) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-methoxy-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]aniline.
| Compound Name | 2-methoxy-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 106921500 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-methoxy-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]aniline |
| SMILES | COc1cccc(Sc2nc(C)co2)c1N |
| InChI | InChI=1S/C11H12N2O2S/c1-7-6-15-11(13-7)16-9-5-3-4-8(14-2)10(9)12/h3-6H,12H2,1-2H3 |
| InChIKey | ACPIADKTCXJFTM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|