C11H9N3OS — CID 106921522
4-amino-3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]benzonitrile (PubChem CID 106921522) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-amino-3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]benzonitrile.
| Compound Name | 4-amino-3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 106921522 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-amino-3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]benzonitrile |
| SMILES | Cc1coc(Sc2cc(C#N)ccc2N)n1 |
| InChI | InChI=1S/C11H9N3OS/c1-7-6-15-11(14-7)16-10-4-8(5-12)2-3-9(10)13/h2-4,6H,13H2,1H3 |
| InChIKey | AKNVECFMKPZBLB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|