C10H9BrN2OS — CID 106921558
3-bromo-4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]aniline (PubChem CID 106921558) has the molecular formula C10H9BrN2OS and a molecular weight of 285.17 g/mol. Its IUPAC name is 3-bromo-4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]aniline.
| Compound Name | 3-bromo-4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 106921558 |
| Molecular Formula | C10H9BrN2OS |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 3-bromo-4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]aniline |
| SMILES | Cc1coc(Sc2ccc(N)cc2Br)n1 |
| InChI | InChI=1S/C10H9BrN2OS/c1-6-5-14-10(13-6)15-9-3-2-7(12)4-8(9)11/h2-5H,12H2,1H3 |
| InChIKey | YMQREKGNAFPOCF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|