C8H9N5OS — CID 106928837
[6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]pyrimidin-4-yl]hydrazine (PubChem CID 106928837) has the molecular formula C8H9N5OS and a molecular weight of 223.26 g/mol. Its IUPAC name is [6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]pyrimidin-4-yl]hydrazine.
| Compound Name | [6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106928837 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | [6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1coc(Sc2cc(NN)ncn2)n1 |
| InChI | InChI=1S/C8H9N5OS/c1-5-3-14-8(12-5)15-7-2-6(13-9)10-4-11-7/h2-4H,9H2,1H3,(H,10,11,13) |
| InChIKey | YZYKXBCJRILBAW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|