C10H10N6OS — CID 106928833
[8-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]imidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 106928833) has the molecular formula C10H10N6OS and a molecular weight of 262.30 g/mol. Its IUPAC name is [8-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]imidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]imidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 106928833 |
| Molecular Formula | C10H10N6OS |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | [8-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]imidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | Cc1coc(Sc2nc(NN)cn3ccnc23)n1 |
| InChI | InChI=1S/C10H10N6OS/c1-6-5-17-10(13-6)18-9-8-12-2-3-16(8)4-7(14-9)15-11/h2-5,15H,11H2,1H3 |
| InChIKey | OLNTURGZIQUXDS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|