C7H7N5S2 — CID 80927170
[6-(1,2,4-thiadiazol-5-ylsulfanyl)-2-pyridinyl]hydrazine (PubChem CID 80927170) has the molecular formula C7H7N5S2 and a molecular weight of 225.30 g/mol. Its IUPAC name is [6-(1,2,4-thiadiazol-5-ylsulfanyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(1,2,4-thiadiazol-5-ylsulfanyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 80927170 |
| Molecular Formula | C7H7N5S2 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | [6-(1,2,4-thiadiazol-5-ylsulfanyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cccc(Sc2ncns2)n1 |
| InChI | InChI=1S/C7H7N5S2/c8-12-5-2-1-3-6(11-5)13-7-9-4-10-14-7/h1-4H,8H2,(H,11,12) |
| InChIKey | NQGKELDVSQRGOT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|