C10H6BrN5S — CID 79947658
6-bromo-8-pyrimidin-2-ylsulfanylimidazo[1,2-a]pyrazine (PubChem CID 79947658) has the molecular formula C10H6BrN5S and a molecular weight of 308.16 g/mol. Its IUPAC name is 6-bromo-8-pyrimidin-2-ylsulfanylimidazo[1,2-a]pyrazine.
| Compound Name | 6-bromo-8-pyrimidin-2-ylsulfanylimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79947658 |
| Molecular Formula | C10H6BrN5S |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 6-bromo-8-pyrimidin-2-ylsulfanylimidazo[1,2-a]pyrazine |
| SMILES | Brc1cn2ccnc2c(Sc2ncccn2)n1 |
| InChI | InChI=1S/C10H6BrN5S/c11-7-6-16-5-4-12-8(16)9(15-7)17-10-13-2-1-3-14-10/h1-6H |
| InChIKey | CFYSITIEMOJHKW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |