C11H6BrN7S — CID 79954521
6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine (PubChem CID 79954521) has the molecular formula C11H6BrN7S and a molecular weight of 348.19 g/mol. Its IUPAC name is 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine.
| Compound Name | 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine |
|---|---|
| PubChem CID | 79954521 |
| Molecular Formula | C11H6BrN7S |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine |
| SMILES | Brc1cn2ccnc2c(Sc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C11H6BrN7S/c12-6-3-19-2-1-13-9(19)11(18-6)20-10-7-8(15-4-14-7)16-5-17-10/h1-5H,(H,14,15,16,17) |
| InChIKey | OQDUHIHEYQPKNH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |