About 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine
6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine (PubChem CID 79954521) has the molecular formula C11H6BrN7S
and a molecular weight of 348.19 g/mol. Its IUPAC name is 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine.
Molecular Properties
| Compound Name | 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine |
| PubChem CID | 79954521 |
| Molecular Formula | C11H6BrN7S |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine |
| SMILES | Brc1cn2ccnc2c(Sc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C11H6BrN7S/c12-6-3-19-2-1-13-9(19)11(18-6)20-10-7-8(15-4-14-7)16-5-17-10/h1-5H,(H,14,15,16,17) |
| InChIKey | OQDUHIHEYQPKNH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine?
The IUPAC name of 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine (CID 79954521) is 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine.
What is the SMILES notation for 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine?
The canonical SMILES for 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine is Brc1cn2ccnc2c(Sc2ncnc3nc[nH]c23)n1.
What is the InChIKey of 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine?
The InChIKey is OQDUHIHEYQPKNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrN7S/c12-6-3-19-2-1-13-9(19)11(18-6)20-10-7-8(15-4-14-7)16-5-17-10/h1-5H,(H,14,15,16,17).
What are the key properties of 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine?
6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine has a molecular weight of 348.19 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-bromoimidazo[1,2-a]pyrazin-8-yl)sulfanyl-7H-purine is sourced from PubChem (CID 79954521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).