C11H12BrN3OS — CID 106494873
6-bromo-8-(oxolan-2-ylmethylsulfanyl)imidazo[1,2-a]pyrazine (PubChem CID 106494873) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is 6-bromo-8-(oxolan-2-ylmethylsulfanyl)imidazo[1,2-a]pyrazine.
| Compound Name | 6-bromo-8-(oxolan-2-ylmethylsulfanyl)imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 106494873 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 6-bromo-8-(oxolan-2-ylmethylsulfanyl)imidazo[1,2-a]pyrazine |
| SMILES | Brc1cn2ccnc2c(SCC2CCCO2)n1 |
| InChI | InChI=1S/C11H12BrN3OS/c12-9-6-15-4-3-13-10(15)11(14-9)17-7-8-2-1-5-16-8/h3-4,6,8H,1-2,5,7H2 |
| InChIKey | OVFXAIXHTFJHSO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |