About 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile
2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile (PubChem CID 107801734) has the molecular formula C13H9BrN6
and a molecular weight of 329.16 g/mol. Its IUPAC name is 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile.
Molecular Properties
| Compound Name | 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile |
| PubChem CID | 107801734 |
| Molecular Formula | C13H9BrN6 |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile |
| SMILES | N#Cc1ccc(Br)cc1Nc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C13H9BrN6/c14-9-2-1-8(6-15)10(5-9)18-12-13-17-3-4-20(13)7-11(16)19-12/h1-5,7H,16H2,(H,18,19) |
| InChIKey | KHLISYAIUAJWCI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile?
The IUPAC name of 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile (CID 107801734) is 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile.
What is the SMILES notation for 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile?
The canonical SMILES for 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile is N#Cc1ccc(Br)cc1Nc1nc(N)cn2ccnc12.
What is the InChIKey of 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile?
The InChIKey is KHLISYAIUAJWCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN6/c14-9-2-1-8(6-15)10(5-9)18-12-13-17-3-4-20(13)7-11(16)19-12/h1-5,7H,16H2,(H,18,19).
What are the key properties of 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile?
2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile has a molecular weight of 329.16 g/mol, XLogP of 2.69, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-4-bromobenzonitrile is sourced from PubChem (CID 107801734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).