C11H7Br2N5 — CID 107801678
2-[(4-amino-6-bromopyrimidin-2-yl)amino]-4-bromobenzonitrile (PubChem CID 107801678) has the molecular formula C11H7Br2N5 and a molecular weight of 369.02 g/mol. Its IUPAC name is 2-[(4-amino-6-bromopyrimidin-2-yl)amino]-4-bromobenzonitrile.
| Compound Name | 2-[(4-amino-6-bromopyrimidin-2-yl)amino]-4-bromobenzonitrile |
|---|---|
| PubChem CID | 107801678 |
| Molecular Formula | C11H7Br2N5 |
| Molecular Weight | 369.02 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | 2-[(4-amino-6-bromopyrimidin-2-yl)amino]-4-bromobenzonitrile |
| SMILES | N#Cc1ccc(Br)cc1Nc1nc(N)cc(Br)n1 |
| InChI | InChI=1S/C11H7Br2N5/c12-7-2-1-6(5-14)8(3-7)16-11-17-9(13)4-10(15)18-11/h1-4H,(H3,15,16,17,18) |
| InChIKey | DVOYCMLFIHLYGW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.02 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |