C11H17N7O — CID 114143250
3-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]-3-methylbutanamide (PubChem CID 114143250) has the molecular formula C11H17N7O and a molecular weight of 263.31 g/mol. Its IUPAC name is 3-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]-3-methylbutanamide.
| Compound Name | 3-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 114143250 |
| Molecular Formula | C11H17N7O |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C11H17N7O/c1-11(2,5-7(12)19)16-9-10-14-3-4-18(10)6-8(15-9)17-13/h3-4,6,17H,5,13H2,1-2H3,(H2,12,19)(H,15,16) |
| InChIKey | AODQECMWQMPQQF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|