C10H14N8O2 — CID 80919250
2-[(2-amino-2-oxoethyl)-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetamide (PubChem CID 80919250) has the molecular formula C10H14N8O2 and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetamide |
|---|---|
| PubChem CID | 80919250 |
| Molecular Formula | C10H14N8O2 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetamide |
| SMILES | NNc1cn2ccnc2c(N(CC(N)=O)CC(N)=O)n1 |
| InChI | InChI=1S/C10H14N8O2/c11-6(19)3-18(4-7(12)20)10-9-14-1-2-17(9)5-8(15-10)16-13/h1-2,5,16H,3-4,13H2,(H2,11,19)(H2,12,20) |
| InChIKey | USQFRFCURGXYDX-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|