C12H20N6 — CID 80932710
6-hydrazinyl-N,N-dipropylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80932710) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-hydrazinyl-N,N-dipropylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N,N-dipropylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80932710 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 6-hydrazinyl-N,N-dipropylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCCN(CCC)c1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C12H20N6/c1-3-6-17(7-4-2)12-11-14-5-8-18(11)9-10(15-12)16-13/h5,8-9,16H,3-4,6-7,13H2,1-2H3 |
| InChIKey | PIUZULZQIUREBO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|