C11H15N5O — CID 103853777
N-(2-but-3-enoxyethyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 103853777) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(2-but-3-enoxyethyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 103853777 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | C=CCCOCCNc1nccn2cnnc12 |
| InChI | InChI=1S/C11H15N5O/c1-2-3-7-17-8-5-13-10-11-15-14-9-16(11)6-4-12-10/h2,4,6,9H,1,3,5,7-8H2,(H,12,13) |
| InChIKey | MNUYZSXJDHTUJU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|