2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid

C9H10N4O2 — CID 104572053

IUPAC2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid
SMILESCCC(C(=O)O)c1nccn2cnnc12
InChIInChI=1S/C9H10N4O2/c1-2-6(9(14)15)7-8-12-11-5-13(8)4-3-10-7/h3-6H,2H2,1H3,(H,14,15)
InChIKeyOFBHVXXJGHHAMA-UHFFFAOYSA-N
MW206.21 g/mol
LogP0.70
Rot. Bonds3

About 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid

2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid (PubChem CID 104572053) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid.

Molecular Properties

Compound Name2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid
PubChem CID104572053
Molecular FormulaC9H10N4O2
Molecular Weight206.21 g/mol
Exact Mass206.08
IUPAC Name2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid
SMILESCCC(C(=O)O)c1nccn2cnnc12
InChIInChI=1S/C9H10N4O2/c1-2-6(9(14)15)7-8-12-11-5-13(8)4-3-10-7/h3-6H,2H2,1H3,(H,14,15)
InChIKeyOFBHVXXJGHHAMA-UHFFFAOYSA-N
XLogP0.70
TPSA80.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.21
LogP ≤ 50.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid?
The IUPAC name of 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid (CID 104572053) is 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid.
What is the SMILES notation for 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid?
The canonical SMILES for 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid is CCC(C(=O)O)c1nccn2cnnc12.
What is the InChIKey of 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid?
The InChIKey is OFBHVXXJGHHAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-2-6(9(14)15)7-8-12-11-5-13(8)4-3-10-7/h3-6H,2H2,1H3,(H,14,15).
What are the key properties of 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid?
2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid has a molecular weight of 206.21 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)butanoic acid is sourced from PubChem (CID 104572053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).