2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid

C8H8N4O2 — CID 83877948

IUPAC2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid
SMILESNC(C(=O)O)c1cccn2cnnc12
InChIInChI=1S/C8H8N4O2/c9-6(8(13)14)5-2-1-3-12-4-10-11-7(5)12/h1-4,6H,9H2,(H,13,14)
InChIKeyKNRIQMDSVFYVCB-UHFFFAOYSA-N
MW192.18 g/mol
LogP-0.19
Rot. Bonds2

About 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid

2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid (PubChem CID 83877948) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid.

Molecular Properties

Compound Name2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid
PubChem CID83877948
Molecular FormulaC8H8N4O2
Molecular Weight192.18 g/mol
Exact Mass192.06
IUPAC Name2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid
SMILESNC(C(=O)O)c1cccn2cnnc12
InChIInChI=1S/C8H8N4O2/c9-6(8(13)14)5-2-1-3-12-4-10-11-7(5)12/h1-4,6H,9H2,(H,13,14)
InChIKeyKNRIQMDSVFYVCB-UHFFFAOYSA-N
XLogP-0.19
TPSA93.51 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.18
LogP ≤ 5-0.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid?
The IUPAC name of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid (CID 83877948) is 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid.
What is the SMILES notation for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid?
The canonical SMILES for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid is NC(C(=O)O)c1cccn2cnnc12.
What is the InChIKey of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid?
The InChIKey is KNRIQMDSVFYVCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c9-6(8(13)14)5-2-1-3-12-4-10-11-7(5)12/h1-4,6H,9H2,(H,13,14).
What are the key properties of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid?
2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid has a molecular weight of 192.18 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid is sourced from PubChem (CID 83877948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).