About 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid
2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid (PubChem CID 83877948) has the molecular formula C8H8N4O2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid.
Analyze 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid?
The IUPAC name of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid (CID 83877948) is 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid.
What is the SMILES notation for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid?
The canonical SMILES for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid is NC(C(=O)O)c1cccn2cnnc12.
What is the InChIKey of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid?
The InChIKey is KNRIQMDSVFYVCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c9-6(8(13)14)5-2-1-3-12-4-10-11-7(5)12/h1-4,6H,9H2,(H,13,14).
What are the key properties of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid?
2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid has a molecular weight of 192.18 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetic acid is sourced from PubChem (CID 83877948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).